About 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid
4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114373037) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 114373037 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid |
| SMILES | CCc1cc(-c2nc(C(C)(C)C)c(C(=O)O)o2)n(CC)n1 |
| InChI | InChI=1S/C15H21N3O3/c1-6-9-8-10(18(7-2)17-9)13-16-12(15(3,4)5)11(21-13)14(19)20/h8H,6-7H2,1-5H3,(H,19,20) |
| InChIKey | NLDGQTSZAYUPAV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid (CID 114373037) is 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid is CCc1cc(-c2nc(C(C)(C)C)c(C(=O)O)o2)n(CC)n1.
What is the InChIKey of 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is NLDGQTSZAYUPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-6-9-8-10(18(7-2)17-9)13-16-12(15(3,4)5)11(21-13)14(19)20/h8H,6-7H2,1-5H3,(H,19,20).
What are the key properties of 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid?
4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 291.35 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(1,3-diethylpyrazol-5-yl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 114373037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).