About 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid
2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114373861) has the molecular formula C12H8ClF2NO4
and a molecular weight of 303.65 g/mol. Its IUPAC name is 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 114373861 |
| Molecular Formula | C12H8ClF2NO4 |
| Molecular Weight | 303.65 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | COCc1nc(-c2cc(F)c(Cl)cc2F)oc1C(=O)O |
| InChI | InChI=1S/C12H8ClF2NO4/c1-19-4-9-10(12(17)18)20-11(16-9)5-2-8(15)6(13)3-7(5)14/h2-3H,4H2,1H3,(H,17,18) |
| InChIKey | WVOGNMQYLTWBFR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid (CID 114373861) is 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid is COCc1nc(-c2cc(F)c(Cl)cc2F)oc1C(=O)O.
What is the InChIKey of 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is WVOGNMQYLTWBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF2NO4/c1-19-4-9-10(12(17)18)20-11(16-9)5-2-8(15)6(13)3-7(5)14/h2-3H,4H2,1H3,(H,17,18).
What are the key properties of 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid?
2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 303.65 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,5-difluorophenyl)-4-(methoxymethyl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 114373861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).