C18H14O3 — CID 11437393
(3Z)-3-[1-(4-methylphenyl)ethylidene]chromene-2,4-dione (PubChem CID 11437393) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3Z)-3-[1-(4-methylphenyl)ethylidene]chromene-2,4-dione.
| Compound Name | (3Z)-3-[1-(4-methylphenyl)ethylidene]chromene-2,4-dione |
|---|---|
| PubChem CID | 11437393 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (3Z)-3-[1-(4-methylphenyl)ethylidene]chromene-2,4-dione |
| SMILES | C/C(=C1/C(=O)Oc2ccccc2C1=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H14O3/c1-11-7-9-13(10-8-11)12(2)16-17(19)14-5-3-4-6-15(14)21-18(16)20/h3-10H,1-2H3/b16-12- |
| InChIKey | WHOXZWIXTRTDAJ-VBKFSLOCSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|