C17H26O3 — CID 11437408
(11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-dien-7-yl)methanol (PubChem CID 11437408) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-dien-7-yl)methanol.
| Compound Name | (11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-dien-7-yl)methanol |
|---|---|
| PubChem CID | 11437408 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (11,14,14-trimethyl-1,4-dioxadispiro[4.2.58.25]pentadeca-6,10-dien-7-yl)methanol |
| SMILES | CC1=CCC2(CC1)C(CO)=CC1(CC2(C)C)OCCO1 |
| InChI | InChI=1S/C17H26O3/c1-13-4-6-16(7-5-13)14(11-18)10-17(12-15(16,2)3)19-8-9-20-17/h4,10,18H,5-9,11-12H2,1-3H3 |
| InChIKey | PMZWALMSGKTCLQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|