C16H16Br2N2O — CID 114374231
2,5-dibromo-N-[3-(ethylaminomethyl)phenyl]benzamide (PubChem CID 114374231) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[3-(ethylaminomethyl)phenyl]benzamide.
| Compound Name | 2,5-dibromo-N-[3-(ethylaminomethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 114374231 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 2,5-dibromo-N-[3-(ethylaminomethyl)phenyl]benzamide |
| SMILES | CCNCc1cccc(NC(=O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C16H16Br2N2O/c1-2-19-10-11-4-3-5-13(8-11)20-16(21)14-9-12(17)6-7-15(14)18/h3-9,19H,2,10H2,1H3,(H,20,21) |
| InChIKey | BGKDFLXVCIXFJW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |