C14H10Br3ClO — CID 114374882
1,4-dibromo-2-[(5-bromo-2-methoxyphenyl)-chloromethyl]benzene (PubChem CID 114374882) has the molecular formula C14H10Br3ClO and a molecular weight of 469.40 g/mol. Its IUPAC name is 1,4-dibromo-2-[(5-bromo-2-methoxyphenyl)-chloromethyl]benzene.
| Compound Name | 1,4-dibromo-2-[(5-bromo-2-methoxyphenyl)-chloromethyl]benzene |
|---|---|
| PubChem CID | 114374882 |
| Molecular Formula | C14H10Br3ClO |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 465.80 |
| IUPAC Name | 1,4-dibromo-2-[(5-bromo-2-methoxyphenyl)-chloromethyl]benzene |
| SMILES | COc1ccc(Br)cc1C(Cl)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H10Br3ClO/c1-19-13-5-3-9(16)7-11(13)14(18)10-6-8(15)2-4-12(10)17/h2-7,14H,1H3 |
| InChIKey | DZQSCOXLOPORFM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|