C15H22O5 — CID 11437514
6,6-dimethoxy-3,3-dimethyl-8-propyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one (PubChem CID 11437514) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6,6-dimethoxy-3,3-dimethyl-8-propyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one.
| Compound Name | 6,6-dimethoxy-3,3-dimethyl-8-propyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
|---|---|
| PubChem CID | 11437514 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6,6-dimethoxy-3,3-dimethyl-8-propyl-1,4-dioxaspiro[4.5]deca-7,9-dien-2-one |
| SMILES | CCCC1=CC(OC)(OC)C2(C=C1)OC(=O)C(C)(C)O2 |
| InChI | InChI=1S/C15H22O5/c1-6-7-11-8-9-14(15(10-11,17-4)18-5)19-12(16)13(2,3)20-14/h8-10H,6-7H2,1-5H3 |
| InChIKey | QYJQQZQIMRXJQT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|