C17H22N4 — CID 11437523
2-[3-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)pyrrolidin-1-yl]ethanamine (PubChem CID 11437523) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[3-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)pyrrolidin-1-yl]ethanamine.
| Compound Name | 2-[3-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)pyrrolidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 11437523 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[3-(2,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-2-yl)pyrrolidin-1-yl]ethanamine |
| SMILES | NCCN1CCC(N2CCc3cncc4cccc2c34)C1 |
| InChI | InChI=1S/C17H22N4/c18-6-9-20-7-5-15(12-20)21-8-4-14-11-19-10-13-2-1-3-16(21)17(13)14/h1-3,10-11,15H,4-9,12,18H2 |
| InChIKey | NLDFZILTNKNTMA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |