C17H34OSi — CID 11437528
tert-butyl-[(3E,5Z)-2,8-dimethylnona-3,5-dien-5-yl]oxy-dimethylsilane (PubChem CID 11437528) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-[(3E,5Z)-2,8-dimethylnona-3,5-dien-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5Z)-2,8-dimethylnona-3,5-dien-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11437528 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-[(3E,5Z)-2,8-dimethylnona-3,5-dien-5-yl]oxy-dimethylsilane |
| SMILES | CC(C)/C=C/C(=C/CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-14(2)10-12-16(13-11-15(3)4)18-19(8,9)17(5,6)7/h10,12-15H,11H2,1-9H3/b12-10+,16-13- |
| InChIKey | NNIFAYYUXLSAJN-YCNRLPBWSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|