C12H9Br2ClS — CID 114375554
2-[2-chloro-2-(2,5-dibromophenyl)ethyl]thiophene (PubChem CID 114375554) has the molecular formula C12H9Br2ClS and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]thiophene.
| Compound Name | 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 114375554 |
| Molecular Formula | C12H9Br2ClS |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 377.85 |
| IUPAC Name | 2-[2-chloro-2-(2,5-dibromophenyl)ethyl]thiophene |
| SMILES | ClC(Cc1cccs1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H9Br2ClS/c13-8-3-4-11(14)10(6-8)12(15)7-9-2-1-5-16-9/h1-6,12H,7H2 |
| InChIKey | BZRUNVMRDHERJM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|