C16H22INO — CID 114375703
N-[[5-iodo-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-2-amine (PubChem CID 114375703) has the molecular formula C16H22INO and a molecular weight of 371.26 g/mol. Its IUPAC name is N-[[5-iodo-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-iodo-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114375703 |
| Molecular Formula | C16H22INO |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | N-[[5-iodo-3-(2-methylpropyl)-1-benzofuran-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)Cc1c(CNC(C)C)oc2ccc(I)cc12 |
| InChI | InChI=1S/C16H22INO/c1-10(2)7-13-14-8-12(17)5-6-15(14)19-16(13)9-18-11(3)4/h5-6,8,10-11,18H,7,9H2,1-4H3 |
| InChIKey | GMYOVVPUVRSICJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|