C18H19NO2 — CID 114375977
(5-phenoxy-3-propyl-1-benzofuran-2-yl)methanamine (PubChem CID 114375977) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (5-phenoxy-3-propyl-1-benzofuran-2-yl)methanamine.
| Compound Name | (5-phenoxy-3-propyl-1-benzofuran-2-yl)methanamine |
|---|---|
| PubChem CID | 114375977 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (5-phenoxy-3-propyl-1-benzofuran-2-yl)methanamine |
| SMILES | CCCc1c(CN)oc2ccc(Oc3ccccc3)cc12 |
| InChI | InChI=1S/C18H19NO2/c1-2-6-15-16-11-14(20-13-7-4-3-5-8-13)9-10-17(16)21-18(15)12-19/h3-5,7-11H,2,6,12,19H2,1H3 |
| InChIKey | WAYWOMOUBXFBJQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |