C20H19NO — CID 11437722
(10Z)-10-(1-phenylethylidene)-1,2,3,10a-tetrahydropyrrolo[1,2-b]isoquinolin-5-one (PubChem CID 11437722) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (10Z)-10-(1-phenylethylidene)-1,2,3,10a-tetrahydropyrrolo[1,2-b]isoquinolin-5-one.
| Compound Name | (10Z)-10-(1-phenylethylidene)-1,2,3,10a-tetrahydropyrrolo[1,2-b]isoquinolin-5-one |
|---|---|
| PubChem CID | 11437722 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (10Z)-10-(1-phenylethylidene)-1,2,3,10a-tetrahydropyrrolo[1,2-b]isoquinolin-5-one |
| SMILES | C/C(=C1\c2ccccc2C(=O)N2CCCC12)c1ccccc1 |
| InChI | InChI=1S/C20H19NO/c1-14(15-8-3-2-4-9-15)19-16-10-5-6-11-17(16)20(22)21-13-7-12-18(19)21/h2-6,8-11,18H,7,12-13H2,1H3/b19-14- |
| InChIKey | WKXFNKCUUQSVEC-RGEXLXHISA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|