C16H20O5 — CID 11437785
2,4,6-trimethoxy-5-[(E)-3-methylbut-1-enyl]benzene-1,3-dicarbaldehyde (PubChem CID 11437785) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2,4,6-trimethoxy-5-[(E)-3-methylbut-1-enyl]benzene-1,3-dicarbaldehyde.
| Compound Name | 2,4,6-trimethoxy-5-[(E)-3-methylbut-1-enyl]benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 11437785 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2,4,6-trimethoxy-5-[(E)-3-methylbut-1-enyl]benzene-1,3-dicarbaldehyde |
| SMILES | COc1c(C=O)c(OC)c(/C=C/C(C)C)c(OC)c1C=O |
| InChI | InChI=1S/C16H20O5/c1-10(2)6-7-11-14(19-3)12(8-17)16(21-5)13(9-18)15(11)20-4/h6-10H,1-5H3/b7-6+ |
| InChIKey | UBLRNBVRGULSLG-VOTSOKGWSA-N |
| XLogP | 3.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|