C11H11ClN4O2S — CID 114379006
3-amino-5-chloro-2-methyl-N-pyrazin-2-ylbenzenesulfonamide (PubChem CID 114379006) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.75 g/mol. Its IUPAC name is 3-amino-5-chloro-2-methyl-N-pyrazin-2-ylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-methyl-N-pyrazin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 114379006 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-amino-5-chloro-2-methyl-N-pyrazin-2-ylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(Cl)cc1S(=O)(=O)Nc1cnccn1 |
| InChI | InChI=1S/C11H11ClN4O2S/c1-7-9(13)4-8(12)5-10(7)19(17,18)16-11-6-14-2-3-15-11/h2-6H,13H2,1H3,(H,15,16) |
| InChIKey | BFWZMBFTODQHAW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|