About (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal
(3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal (PubChem CID 11437943) has the molecular formula C14H19NO6
and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal.
Molecular Properties
| Compound Name | (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal |
| PubChem CID | 11437943 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal |
| SMILES | COc1cc([N+](=O)[O-])c(OC)c(C[C@@H](C)CC=O)c1OC |
| InChI | InChI=1S/C14H19NO6/c1-9(5-6-16)7-10-13(20-3)11(15(17)18)8-12(19-2)14(10)21-4/h6,8-9H,5,7H2,1-4H3/t9-/m0/s1 |
| InChIKey | WKFLLPLRQDPHRO-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal?
The IUPAC name of (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal (CID 11437943) is (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal.
What is the SMILES notation for (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal?
The canonical SMILES for (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal is COc1cc([N+](=O)[O-])c(OC)c(C[C@@H](C)CC=O)c1OC.
What is the InChIKey of (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal?
The InChIKey is WKFLLPLRQDPHRO-VIFPVBQESA-N. The full InChI is InChI=1S/C14H19NO6/c1-9(5-6-16)7-10-13(20-3)11(15(17)18)8-12(19-2)14(10)21-4/h6,8-9H,5,7H2,1-4H3/t9-/m0/s1.
What are the key properties of (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal?
(3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal has a molecular weight of 297.31 g/mol, XLogP of 2.39, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-4-(2,3,6-trimethoxy-5-nitrophenyl)butanal is sourced from PubChem (CID 11437943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).