C13H16ClN3OS — CID 11437965
3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 11437965) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11437965 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[(2-chlorophenyl)-hydroxymethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)Cn1c(C(O)c2ccccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C13H16ClN3OS/c1-8(2)7-17-12(15-16-13(17)19)11(18)9-5-3-4-6-10(9)14/h3-6,8,11,18H,7H2,1-2H3,(H,16,19) |
| InChIKey | XGIGFURMUCHZRO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|