About N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide
N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide (PubChem CID 11437974) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide |
| PubChem CID | 11437974 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide |
| SMILES | CCn1c(=O)c(NC(C)=O)cc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C16H14N2O4/c1-3-18-14-10-6-4-5-7-13(10)22-16(21)11(14)8-12(15(18)20)17-9(2)19/h4-8H,3H2,1-2H3,(H,17,19) |
| InChIKey | VAUZJMDDOBLQFD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide?
The IUPAC name of N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide (CID 11437974) is N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide.
What is the SMILES notation for N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide?
The canonical SMILES for N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide is CCn1c(=O)c(NC(C)=O)cc2c(=O)oc3ccccc3c21.
What is the InChIKey of N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide?
The InChIKey is VAUZJMDDOBLQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-3-18-14-10-6-4-5-7-13(10)22-16(21)11(14)8-12(15(18)20)17-9(2)19/h4-8H,3H2,1-2H3,(H,17,19).
What are the key properties of N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide?
N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide has a molecular weight of 298.30 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-ethyl-2,5-dioxochromeno[4,3-b]pyridin-3-yl)acetamide is sourced from PubChem (CID 11437974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).