C15H11ClN4O — CID 11437999
2-(3-chloro-2-methylanilino)-7-hydroxy-3H-benzimidazole-5-carbonitrile (PubChem CID 11437999) has the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)-7-hydroxy-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-(3-chloro-2-methylanilino)-7-hydroxy-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 11437999 |
| Molecular Formula | C15H11ClN4O |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(3-chloro-2-methylanilino)-7-hydroxy-3H-benzimidazole-5-carbonitrile |
| SMILES | Cc1c(Cl)cccc1Nc1nc2c(O)cc(C#N)cc2[nH]1 |
| InChI | InChI=1S/C15H11ClN4O/c1-8-10(16)3-2-4-11(8)18-15-19-12-5-9(7-17)6-13(21)14(12)20-15/h2-6,21H,1H3,(H2,18,19,20) |
| InChIKey | ZMAULPCAHIDZOD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |