C14H20O7 — CID 11438035
[(2R,4S,5E,7S,8S)-7-acetyloxy-4-hydroxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate (PubChem CID 11438035) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is [(2R,4S,5E,7S,8S)-7-acetyloxy-4-hydroxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate.
| Compound Name | [(2R,4S,5E,7S,8S)-7-acetyloxy-4-hydroxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate |
|---|---|
| PubChem CID | 11438035 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(2R,4S,5E,7S,8S)-7-acetyloxy-4-hydroxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@@H](O)C[C@@H](C)OC(=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O7/c1-8-6-11(17)4-5-12(20-9(2)15)13(21-10(3)16)7-14(18)19-8/h4-5,8,11-13,17H,6-7H2,1-3H3/b5-4+/t8-,11-,12+,13+/m1/s1 |
| InChIKey | XNEZXKRBAUPSNJ-MLTVRYQVSA-N |
| XLogP | 0.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|