C14H16BrNO4 — CID 114382169
3-(4-bromo-2-nitrophenyl)-2-cyclopentylpropanoic acid (PubChem CID 114382169) has the molecular formula C14H16BrNO4 and a molecular weight of 342.19 g/mol. Its IUPAC name is 3-(4-bromo-2-nitrophenyl)-2-cyclopentylpropanoic acid.
| Compound Name | 3-(4-bromo-2-nitrophenyl)-2-cyclopentylpropanoic acid |
|---|---|
| PubChem CID | 114382169 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 3-(4-bromo-2-nitrophenyl)-2-cyclopentylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccc(Br)cc1[N+](=O)[O-])C1CCCC1 |
| InChI | InChI=1S/C14H16BrNO4/c15-11-6-5-10(13(8-11)16(19)20)7-12(14(17)18)9-3-1-2-4-9/h5-6,8-9,12H,1-4,7H2,(H,17,18) |
| InChIKey | PABZSTOJZPCAOO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|