C19H36OSi — CID 11438269
tri(propan-2-yl)-(4,4,7-trimethylcyclohepta-1,6-dien-1-yl)oxysilane (PubChem CID 11438269) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is tri(propan-2-yl)-(4,4,7-trimethylcyclohepta-1,6-dien-1-yl)oxysilane.
| Compound Name | tri(propan-2-yl)-(4,4,7-trimethylcyclohepta-1,6-dien-1-yl)oxysilane |
|---|---|
| PubChem CID | 11438269 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tri(propan-2-yl)-(4,4,7-trimethylcyclohepta-1,6-dien-1-yl)oxysilane |
| SMILES | CC1=CCC(C)(C)CC=C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36OSi/c1-14(2)21(15(3)4,16(5)6)20-18-11-13-19(8,9)12-10-17(18)7/h10-11,14-16H,12-13H2,1-9H3 |
| InChIKey | RTRYPRRQGJTORE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|