C14H18N4O — CID 114383176
5,6-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1,2,4-triazin-3-amine (PubChem CID 114383176) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 5,6-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114383176 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5,6-dimethyl-N-[2-(3-methylphenoxy)ethyl]-1,2,4-triazin-3-amine |
| SMILES | Cc1cccc(OCCNc2nnc(C)c(C)n2)c1 |
| InChI | InChI=1S/C14H18N4O/c1-10-5-4-6-13(9-10)19-8-7-15-14-16-11(2)12(3)17-18-14/h4-6,9H,7-8H2,1-3H3,(H,15,16,18) |
| InChIKey | SNPGNKZPYTWJFF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|