C10H18N4O — CID 114383247
1-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]pentan-2-ol (PubChem CID 114383247) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]pentan-2-ol.
| Compound Name | 1-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 114383247 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[(5,6-dimethyl-1,2,4-triazin-3-yl)amino]pentan-2-ol |
| SMILES | CCCC(O)CNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H18N4O/c1-4-5-9(15)6-11-10-12-7(2)8(3)13-14-10/h9,15H,4-6H2,1-3H3,(H,11,12,14) |
| InChIKey | ZIPDYDZXVBOILZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |