About N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide
N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide (PubChem CID 114383532) has the molecular formula C6H10F2N6O
and a molecular weight of 220.18 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide |
| PubChem CID | 114383532 |
| Molecular Formula | C6H10F2N6O |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide |
| SMILES | NCC(F)(F)CNC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C6H10F2N6O/c7-6(8,2-9)3-10-5(15)1-14-4-11-12-13-14/h4H,1-3,9H2,(H,10,15) |
| InChIKey | XQVCSCVCZBBTOJ-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide (CID 114383532) is N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide is NCC(F)(F)CNC(=O)Cn1cnnn1.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide?
The InChIKey is XQVCSCVCZBBTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N6O/c7-6(8,2-9)3-10-5(15)1-14-4-11-12-13-14/h4H,1-3,9H2,(H,10,15).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide?
N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide has a molecular weight of 220.18 g/mol, XLogP of -1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-2-(tetrazol-1-yl)acetamide is sourced from PubChem (CID 114383532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).