About N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide
N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 114383762) has the molecular formula C8H11F2N3O2
and a molecular weight of 219.19 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 114383762 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C8H11F2N3O2/c1-5-2-13-15-6(5)7(14)12-4-8(9,10)3-11/h2H,3-4,11H2,1H3,(H,12,14) |
| InChIKey | NPUDEOBRPQQUFX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide (CID 114383762) is N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide is Cc1cnoc1C(=O)NCC(F)(F)CN.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is NPUDEOBRPQQUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O2/c1-5-2-13-15-6(5)7(14)12-4-8(9,10)3-11/h2H,3-4,11H2,1H3,(H,12,14).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide?
N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 219.19 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-4-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 114383762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).