C16H18F3NO2 — CID 11438383
1-benzyl-5-ethyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate (PubChem CID 11438383) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-benzyl-5-ethyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11438383 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-benzyl-5-ethyl-2,3-dihydropyridin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCC1=CCC[N+](Cc2ccccc2)=C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H18N.C2HF3O2/c1-2-13-9-6-10-15(11-13)12-14-7-4-3-5-8-14;3-2(4,5)1(6)7/h3-5,7-9,11H,2,6,10,12H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | ANEZGMUVIKUGTP-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|