About N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide
N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 114384024) has the molecular formula C7H12F2N4O2S
and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 114384024 |
| Molecular Formula | C7H12F2N4O2S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C7H12F2N4O2S/c1-5-6(2-11-13-5)16(14,15)12-4-7(8,9)3-10/h2,12H,3-4,10H2,1H3,(H,11,13) |
| InChIKey | CMCLYDLUDRNANW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide (CID 114384024) is N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide is Cc1[nH]ncc1S(=O)(=O)NCC(F)(F)CN.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide?
The InChIKey is CMCLYDLUDRNANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N4O2S/c1-5-6(2-11-13-5)16(14,15)12-4-7(8,9)3-10/h2,12H,3-4,10H2,1H3,(H,11,13).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide?
N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide has a molecular weight of 254.26 g/mol, XLogP of -0.41, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-5-methyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 114384024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).