About methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate
methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate (PubChem CID 114384285) has the molecular formula C9H12F2N4O2
and a molecular weight of 246.22 g/mol. Its IUPAC name is methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate |
| PubChem CID | 114384285 |
| Molecular Formula | C9H12F2N4O2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nccc(NCC(F)(F)CN)n1 |
| InChI | InChI=1S/C9H12F2N4O2/c1-17-8(16)7-13-3-2-6(15-7)14-5-9(10,11)4-12/h2-3H,4-5,12H2,1H3,(H,13,14,15) |
| InChIKey | SISRGKFWGWKKNV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate?
The IUPAC name of methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate (CID 114384285) is methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate.
What is the SMILES notation for methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate?
The canonical SMILES for methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate is COC(=O)c1nccc(NCC(F)(F)CN)n1.
What is the InChIKey of methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate?
The InChIKey is SISRGKFWGWKKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N4O2/c1-17-8(16)7-13-3-2-6(15-7)14-5-9(10,11)4-12/h2-3H,4-5,12H2,1H3,(H,13,14,15).
What are the key properties of methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate?
methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate has a molecular weight of 246.22 g/mol, XLogP of 0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3-amino-2,2-difluoropropyl)amino]pyrimidine-2-carboxylate is sourced from PubChem (CID 114384285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).