C11H13F2N3O — CID 114384341
2-[(3-amino-2,2-difluoropropyl)amino]-4-methoxybenzonitrile (PubChem CID 114384341) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-[(3-amino-2,2-difluoropropyl)amino]-4-methoxybenzonitrile.
| Compound Name | 2-[(3-amino-2,2-difluoropropyl)amino]-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 114384341 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(3-amino-2,2-difluoropropyl)amino]-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(NCC(F)(F)CN)c1 |
| InChI | InChI=1S/C11H13F2N3O/c1-17-9-3-2-8(5-14)10(4-9)16-7-11(12,13)6-15/h2-4,16H,6-7,15H2,1H3 |
| InChIKey | OGKXJWNNVOEBLY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |