About 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine
2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine (PubChem CID 114384368) has the molecular formula C12H14F2N4
and a molecular weight of 252.27 g/mol. Its IUPAC name is 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine |
| PubChem CID | 114384368 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine |
| SMILES | Cc1nc2ccccc2nc1NCC(F)(F)CN |
| InChI | InChI=1S/C12H14F2N4/c1-8-11(16-7-12(13,14)6-15)18-10-5-3-2-4-9(10)17-8/h2-5H,6-7,15H2,1H3,(H,16,18) |
| InChIKey | VXPJFVOKPIOITJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine?
The IUPAC name of 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine (CID 114384368) is 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine.
What is the SMILES notation for 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine?
The canonical SMILES for 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine is Cc1nc2ccccc2nc1NCC(F)(F)CN.
What is the InChIKey of 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine?
The InChIKey is VXPJFVOKPIOITJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N4/c1-8-11(16-7-12(13,14)6-15)18-10-5-3-2-4-9(10)17-8/h2-5H,6-7,15H2,1H3,(H,16,18).
What are the key properties of 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine?
2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine has a molecular weight of 252.27 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N'-(3-methylquinoxalin-2-yl)propane-1,3-diamine is sourced from PubChem (CID 114384368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).