About 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine
2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine (PubChem CID 114384377) has the molecular formula C10H16F2N4O
and a molecular weight of 246.26 g/mol. Its IUPAC name is 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine |
| PubChem CID | 114384377 |
| Molecular Formula | C10H16F2N4O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine |
| SMILES | CC(C)Oc1cncc(NCC(F)(F)CN)n1 |
| InChI | InChI=1S/C10H16F2N4O/c1-7(2)17-9-4-14-3-8(16-9)15-6-10(11,12)5-13/h3-4,7H,5-6,13H2,1-2H3,(H,15,16) |
| InChIKey | MMZJKHHWVLJIAZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine?
The IUPAC name of 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine (CID 114384377) is 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine.
What is the SMILES notation for 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine?
The canonical SMILES for 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine is CC(C)Oc1cncc(NCC(F)(F)CN)n1.
What is the InChIKey of 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine?
The InChIKey is MMZJKHHWVLJIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N4O/c1-7(2)17-9-4-14-3-8(16-9)15-6-10(11,12)5-13/h3-4,7H,5-6,13H2,1-2H3,(H,15,16).
What are the key properties of 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine?
2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine has a molecular weight of 246.26 g/mol, XLogP of 1.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-N'-(6-propan-2-yloxypyrazin-2-yl)propane-1,3-diamine is sourced from PubChem (CID 114384377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).