C8H9F2N5O2S — CID 114384415
2,2-difluoro-N'-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propane-1,3-diamine (PubChem CID 114384415) has the molecular formula C8H9F2N5O2S and a molecular weight of 277.26 g/mol. Its IUPAC name is 2,2-difluoro-N'-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propane-1,3-diamine.
| Compound Name | 2,2-difluoro-N'-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114384415 |
| Molecular Formula | C8H9F2N5O2S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2,2-difluoro-N'-(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)propane-1,3-diamine |
| SMILES | NCC(F)(F)CNc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9F2N5O2S/c9-8(10,3-11)4-12-5-6(15(16)17)14-1-2-18-7(14)13-5/h1-2,12H,3-4,11H2 |
| InChIKey | VKDIWUXKMZHAQE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|