C10H14F2N2O2 — CID 114384527
3-(3-amino-2,2-difluoropropyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 114384527) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(3-amino-2,2-difluoropropyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(3-amino-2,2-difluoropropyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 114384527 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(3-amino-2,2-difluoropropyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC1(C)C2C(=O)N(CC(F)(F)CN)C(=O)C21 |
| InChI | InChI=1S/C10H14F2N2O2/c1-9(2)5-6(9)8(16)14(7(5)15)4-10(11,12)3-13/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | SJMMSDZBMXBTQC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|