About 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione
8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 114384559) has the molecular formula C12H18F2N2O2
and a molecular weight of 260.28 g/mol. Its IUPAC name is 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione.
Molecular Properties
| Compound Name | 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione |
| PubChem CID | 114384559 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | NCC(F)(F)CN1C(=O)CC2(CCCC2)CC1=O |
| InChI | InChI=1S/C12H18F2N2O2/c13-12(14,7-15)8-16-9(17)5-11(6-10(16)18)3-1-2-4-11/h1-8,15H2 |
| InChIKey | ORBQGTDGIKXHQB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione?
The IUPAC name of 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione (CID 114384559) is 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione.
What is the SMILES notation for 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione?
The canonical SMILES for 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione is NCC(F)(F)CN1C(=O)CC2(CCCC2)CC1=O.
What is the InChIKey of 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione?
The InChIKey is ORBQGTDGIKXHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2O2/c13-12(14,7-15)8-16-9(17)5-11(6-10(16)18)3-1-2-4-11/h1-8,15H2.
What are the key properties of 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione?
8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione has a molecular weight of 260.28 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-amino-2,2-difluoropropyl)-8-azaspiro[4.5]decane-7,9-dione is sourced from PubChem (CID 114384559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).