C11H25N3O2S — CID 114384646
2-[[4-(ethylamino)cyclohexyl]-methylamino]ethanesulfonamide (PubChem CID 114384646) has the molecular formula C11H25N3O2S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-[[4-(ethylamino)cyclohexyl]-methylamino]ethanesulfonamide.
| Compound Name | 2-[[4-(ethylamino)cyclohexyl]-methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 114384646 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-[[4-(ethylamino)cyclohexyl]-methylamino]ethanesulfonamide |
| SMILES | CCNC1CCC(N(C)CCS(N)(=O)=O)CC1 |
| InChI | InChI=1S/C11H25N3O2S/c1-3-13-10-4-6-11(7-5-10)14(2)8-9-17(12,15)16/h10-11,13H,3-9H2,1-2H3,(H2,12,15,16) |
| InChIKey | LEZOWYDVHSHEKJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |