About (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol
(1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol (PubChem CID 11438513) has the molecular formula C22H23NO
and a molecular weight of 317.43 g/mol. Its IUPAC name is (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol |
| PubChem CID | 11438513 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol |
| SMILES | CN(Cc1ccccc1)[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO/c1-23(17-18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)22(24)20-15-9-4-10-16-20/h2-16,21-22,24H,17H2,1H3/t21-,22+/m0/s1 |
| InChIKey | XKGVODLIURNSDV-FCHUYYIVSA-N |
| XLogP | 4.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol?
The IUPAC name of (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol (CID 11438513) is (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol.
What is the SMILES notation for (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol?
The canonical SMILES for (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol is CN(Cc1ccccc1)[C@@H](c1ccccc1)[C@H](O)c1ccccc1.
What is the InChIKey of (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol?
The InChIKey is XKGVODLIURNSDV-FCHUYYIVSA-N. The full InChI is InChI=1S/C22H23NO/c1-23(17-18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)22(24)20-15-9-4-10-16-20/h2-16,21-22,24H,17H2,1H3/t21-,22+/m0/s1.
What are the key properties of (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol?
(1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol has a molecular weight of 317.43 g/mol, XLogP of 4.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-[benzyl(methyl)amino]-1,2-diphenylethanol is sourced from PubChem (CID 11438513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).