C20H30O3 — CID 11438543
(1R,6S,7S,10S,11S)-10-hydroxy-7,10,14-trimethyl-6-propan-2-yl-15-oxatricyclo[9.3.1.03,7]pentadeca-3,13-dien-9-one (PubChem CID 11438543) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,6S,7S,10S,11S)-10-hydroxy-7,10,14-trimethyl-6-propan-2-yl-15-oxatricyclo[9.3.1.03,7]pentadeca-3,13-dien-9-one.
| Compound Name | (1R,6S,7S,10S,11S)-10-hydroxy-7,10,14-trimethyl-6-propan-2-yl-15-oxatricyclo[9.3.1.03,7]pentadeca-3,13-dien-9-one |
|---|---|
| PubChem CID | 11438543 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,6S,7S,10S,11S)-10-hydroxy-7,10,14-trimethyl-6-propan-2-yl-15-oxatricyclo[9.3.1.03,7]pentadeca-3,13-dien-9-one |
| SMILES | CC1=CC[C@@H]2O[C@@H]1CC1=CC[C@@H](C(C)C)[C@]1(C)CC(=O)[C@@]2(C)O |
| InChI | InChI=1S/C20H30O3/c1-12(2)15-8-7-14-10-16-13(3)6-9-18(23-16)20(5,22)17(21)11-19(14,15)4/h6-7,12,15-16,18,22H,8-11H2,1-5H3/t15-,16+,18-,19+,20+/m0/s1 |
| InChIKey | LYULCTGPWDMVAO-KRFUXDQASA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|