C9H6Br2N2OS — CID 114386335
4,5-dibromo-2-(thiophen-3-ylmethyl)pyridazin-3-one (PubChem CID 114386335) has the molecular formula C9H6Br2N2OS and a molecular weight of 350.04 g/mol. Its IUPAC name is 4,5-dibromo-2-(thiophen-3-ylmethyl)pyridazin-3-one.
| Compound Name | 4,5-dibromo-2-(thiophen-3-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114386335 |
| Molecular Formula | C9H6Br2N2OS |
| Molecular Weight | 350.04 g/mol |
| Exact Mass | 347.86 |
| IUPAC Name | 4,5-dibromo-2-(thiophen-3-ylmethyl)pyridazin-3-one |
| SMILES | O=c1c(Br)c(Br)cnn1Cc1ccsc1 |
| InChI | InChI=1S/C9H6Br2N2OS/c10-7-3-12-13(9(14)8(7)11)4-6-1-2-15-5-6/h1-3,5H,4H2 |
| InChIKey | PZVVFYDELXYTKR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.04 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |