C12H9Br2N3O3 — CID 114386384
4,5-dibromo-2-[2-(4-nitrophenyl)ethyl]pyridazin-3-one (PubChem CID 114386384) has the molecular formula C12H9Br2N3O3 and a molecular weight of 403.03 g/mol. Its IUPAC name is 4,5-dibromo-2-[2-(4-nitrophenyl)ethyl]pyridazin-3-one.
| Compound Name | 4,5-dibromo-2-[2-(4-nitrophenyl)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114386384 |
| Molecular Formula | C12H9Br2N3O3 |
| Molecular Weight | 403.03 g/mol |
| Exact Mass | 400.90 |
| IUPAC Name | 4,5-dibromo-2-[2-(4-nitrophenyl)ethyl]pyridazin-3-one |
| SMILES | O=c1c(Br)c(Br)cnn1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9Br2N3O3/c13-10-7-15-16(12(18)11(10)14)6-5-8-1-3-9(4-2-8)17(19)20/h1-4,7H,5-6H2 |
| InChIKey | IJUXUVSDGCTXGQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.03 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|