C18H17N3O3 — CID 11438688
N-[(2R,6S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-2-pyridin-4-ylacetamide (PubChem CID 11438688) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[(2R,6S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-2-pyridin-4-ylacetamide.
| Compound Name | N-[(2R,6S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-2-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 11438688 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(2R,6S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-2-pyridin-4-ylacetamide |
| SMILES | O=C(Cc1ccncc1)NN1C(=O)[C@@H]2C3C=CC(C4CC43)[C@@H]2C1=O |
| InChI | InChI=1S/C18H17N3O3/c22-14(7-9-3-5-19-6-4-9)20-21-17(23)15-10-1-2-11(13-8-12(10)13)16(15)18(21)24/h1-6,10-13,15-16H,7-8H2,(H,20,22)/t10?,11?,12?,13?,15-,16+ |
| InChIKey | HGOZFVZTVSHXND-MGXKEQJRSA-N |
| XLogP | 0.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|