C15H19N5O — CID 114387555
2-(4-aminophenyl)-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanamide (PubChem CID 114387555) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanamide.
| Compound Name | 2-(4-aminophenyl)-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 114387555 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(4-aminophenyl)-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methylpropanamide |
| SMILES | Cc1nnc(NC(=O)C(C)(C)c2ccc(N)cc2)nc1C |
| InChI | InChI=1S/C15H19N5O/c1-9-10(2)19-20-14(17-9)18-13(21)15(3,4)11-5-7-12(16)8-6-11/h5-8H,16H2,1-4H3,(H,17,18,20,21) |
| InChIKey | WEVBULXAWYCHIW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|