About 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide
6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide (PubChem CID 114387822) has the molecular formula C11H19N5O
and a molecular weight of 237.31 g/mol. Its IUPAC name is 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide.
Molecular Properties
| Compound Name | 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide |
| PubChem CID | 114387822 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide |
| SMILES | CCC(CCN)CCC(=O)Nc1nccnn1 |
| InChI | InChI=1S/C11H19N5O/c1-2-9(5-6-12)3-4-10(17)15-11-13-7-8-14-16-11/h7-9H,2-6,12H2,1H3,(H,13,15,16,17) |
| InChIKey | MZSFHCHNUDVNPR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide?
The IUPAC name of 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide (CID 114387822) is 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide.
What is the SMILES notation for 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide?
The canonical SMILES for 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide is CCC(CCN)CCC(=O)Nc1nccnn1.
What is the InChIKey of 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide?
The InChIKey is MZSFHCHNUDVNPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O/c1-2-9(5-6-12)3-4-10(17)15-11-13-7-8-14-16-11/h7-9H,2-6,12H2,1H3,(H,13,15,16,17).
What are the key properties of 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide?
6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide has a molecular weight of 237.31 g/mol, XLogP of 0.97, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-ethyl-N-(1,2,4-triazin-3-yl)hexanamide is sourced from PubChem (CID 114387822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).