C14H13N5O — CID 114387927
2-cyano-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-phenylacetamide (PubChem CID 114387927) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-cyano-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-phenylacetamide.
| Compound Name | 2-cyano-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 114387927 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-cyano-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-phenylacetamide |
| SMILES | Cc1nnc(NC(=O)C(C#N)c2ccccc2)nc1C |
| InChI | InChI=1S/C14H13N5O/c1-9-10(2)18-19-14(16-9)17-13(20)12(8-15)11-6-4-3-5-7-11/h3-7,12H,1-2H3,(H,16,17,19,20) |
| InChIKey | ARNQIGCHUPGBHQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |