About 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide
1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide (PubChem CID 114387955) has the molecular formula C9H9N5O
and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide |
| PubChem CID | 114387955 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2nccnn2)CCC1 |
| InChI | InChI=1S/C9H9N5O/c10-6-9(2-1-3-9)7(15)13-8-11-4-5-12-14-8/h4-5H,1-3H2,(H,11,13,14,15) |
| InChIKey | JWRIFIBCEUXWQS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide?
The IUPAC name of 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide (CID 114387955) is 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide is N#CC1(C(=O)Nc2nccnn2)CCC1.
What is the InChIKey of 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide?
The InChIKey is JWRIFIBCEUXWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N5O/c10-6-9(2-1-3-9)7(15)13-8-11-4-5-12-14-8/h4-5H,1-3H2,(H,11,13,14,15).
What are the key properties of 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide?
1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide has a molecular weight of 203.20 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(1,2,4-triazin-3-yl)cyclobutane-1-carboxamide is sourced from PubChem (CID 114387955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).