C10H8N6OS — CID 114388033
5-carbamothioyl-N-(1,2,4-triazin-3-yl)pyridine-2-carboxamide (PubChem CID 114388033) has the molecular formula C10H8N6OS and a molecular weight of 260.28 g/mol. Its IUPAC name is 5-carbamothioyl-N-(1,2,4-triazin-3-yl)pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-(1,2,4-triazin-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114388033 |
| Molecular Formula | C10H8N6OS |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-carbamothioyl-N-(1,2,4-triazin-3-yl)pyridine-2-carboxamide |
| SMILES | NC(=S)c1ccc(C(=O)Nc2nccnn2)nc1 |
| InChI | InChI=1S/C10H8N6OS/c11-8(18)6-1-2-7(13-5-6)9(17)15-10-12-3-4-14-16-10/h1-5H,(H2,11,18)(H,12,15,16,17) |
| InChIKey | WKIVCWQFLDEPCV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|