C18H34O3Si — CID 11438809
tert-butyl-dimethyl-[[(2S,3S)-3-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]silane (PubChem CID 11438809) has the molecular formula C18H34O3Si and a molecular weight of 326.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2S,3S)-3-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2S,3S)-3-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 11438809 |
| Molecular Formula | C18H34O3Si |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(2S,3S)-3-[(E)-prop-1-enyl]-1,4-dioxaspiro[4.5]decan-2-yl]methoxy]silane |
| SMILES | C/C=C/[C@@H]1OC2(CCCCC2)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3Si/c1-7-11-15-16(14-19-22(5,6)17(2,3)4)21-18(20-15)12-9-8-10-13-18/h7,11,15-16H,8-10,12-14H2,1-6H3/b11-7+/t15-,16-/m0/s1 |
| InChIKey | NVQQIDRFFXMKQW-NMHAMGRWSA-N |
| XLogP | 5.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|