About 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile
3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile (PubChem CID 114388294) has the molecular formula C8H15N3O2S
and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile.
Molecular Properties
| Compound Name | 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile |
| PubChem CID | 114388294 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile |
| SMILES | CC(C)(C#N)CNS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H15N3O2S/c1-8(2,5-9)6-10-14(12,13)11-7-3-4-7/h7,10-11H,3-4,6H2,1-2H3 |
| InChIKey | YGJDXACWYAGHKE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile?
The IUPAC name of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile (CID 114388294) is 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile.
What is the SMILES notation for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile?
The canonical SMILES for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile is CC(C)(C#N)CNS(=O)(=O)NC1CC1.
What is the InChIKey of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile?
The InChIKey is YGJDXACWYAGHKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2S/c1-8(2,5-9)6-10-14(12,13)11-7-3-4-7/h7,10-11H,3-4,6H2,1-2H3.
What are the key properties of 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile?
3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile has a molecular weight of 217.29 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopropylsulfamoylamino)-2,2-dimethylpropanenitrile is sourced from PubChem (CID 114388294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).