C10H15N5O3 — CID 114388772
3-methyl-2-(1,2,4-triazin-3-ylcarbamoylamino)pentanoic acid (PubChem CID 114388772) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 3-methyl-2-(1,2,4-triazin-3-ylcarbamoylamino)pentanoic acid.
| Compound Name | 3-methyl-2-(1,2,4-triazin-3-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 114388772 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-methyl-2-(1,2,4-triazin-3-ylcarbamoylamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)Nc1nccnn1)C(=O)O |
| InChI | InChI=1S/C10H15N5O3/c1-3-6(2)7(8(16)17)13-10(18)14-9-11-4-5-12-15-9/h4-7H,3H2,1-2H3,(H,16,17)(H2,11,13,14,15,18) |
| InChIKey | CISVDSAMTBBVGD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |