C7H8N6O2S — CID 114388868
2-methyl-N-(1,2,4-triazin-3-yl)-1H-imidazole-5-sulfonamide (PubChem CID 114388868) has the molecular formula C7H8N6O2S and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-methyl-N-(1,2,4-triazin-3-yl)-1H-imidazole-5-sulfonamide.
| Compound Name | 2-methyl-N-(1,2,4-triazin-3-yl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 114388868 |
| Molecular Formula | C7H8N6O2S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-methyl-N-(1,2,4-triazin-3-yl)-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2nccnn2)[nH]1 |
| InChI | InChI=1S/C7H8N6O2S/c1-5-9-4-6(11-5)16(14,15)13-7-8-2-3-10-12-7/h2-4H,1H3,(H,9,11)(H,8,12,13) |
| InChIKey | FGJZBCYSUXBMMO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |